Difference between revisions of "N-Acetyl-beta-D-Hexosaminides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] == * direction: ** REVERSIBLE * common name: ** 4-hydroxy-3-methylbut-2-en-1-yl diphosphat...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HDS HDS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C[S+](CCC([N+])C(=O)[O-])C
 +
* inchi key:
 +
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
 
* common name:
 
* common name:
−
** 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase
+
** S-methyl-L-methionine
 +
* molecular weight:
 +
** 164.242   
 
* Synonym(s):
 
* Synonym(s):
 +
** S-methylmethionine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[MMUM-RXN]]
−
** 1.0 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][h] '''+''' 1.0 [[Protein-Dithiols]][h] '''<=>''' 1.0 [[HYDROXY-METHYL-BUTENYL-DIP]][h] '''+''' 1.0 [[WATER]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[Protein-Disulfides]][h]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[h] '''+''' 1.0 a protein dithiol[h] '''<=>''' 1.0 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[h] '''+''' 1.0 H2O[h] '''+''' 1.0 H+[h] '''+''' 1.0 a protein disulfide[h]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15758]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
−
{{#set: gene associated=Tiso_gene_15758}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
−
{{#set: reconstruction category=orthology}}
+
* BIGG : mmet
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
 +
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
 +
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
 +
{{#set: common name=S-methyl-L-methionine}}
 +
{{#set: molecular weight=164.242    }}
 +
{{#set: common name=S-methylmethionine}}
 +
{{#set: consumed by=MMUM-RXN}}

Revision as of 19:54, 18 March 2018

Metabolite CPD-397

  • smiles:
    • C[S+](CCC([N+])C(=O)[O-])C
  • inchi key:
    • InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
  • common name:
    • S-methyl-L-methionine
  • molecular weight:
    • 164.242
  • Synonym(s):
    • S-methylmethionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Acetyl-beta-D-Hexosaminides&oldid=27759"