Difference between revisions of "ADENOSINE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10122 == * Synonym(s): == Reactions associated == * NAD+-ADP-RIBOSYLTRANSFERASE-RXN ** in-silico_annotation ***ec-number == Pathways a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_10122 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] ==
 +
* smiles:
 +
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
 +
* common name:
 +
** gibberellin A19
 +
* molecular weight:
 +
** 360.406   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA19
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* [[RXN1F-169]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN1F-168]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034]
 +
* HMDB : HMDB36896
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}}
 +
{{#set: common name=gibberellin A19}}
 +
{{#set: molecular weight=360.406    }}
 +
{{#set: common name=GA19}}
 +
{{#set: consumed by=RXN1F-169}}
 +
{{#set: produced by=RXN1F-168}}

Revision as of 18:55, 18 March 2018

Metabolite CPD1F-96

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
  • common name:
    • gibberellin A19
  • molecular weight:
    • 360.406
  • Synonym(s):
    • GA19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.