Difference between revisions of "ADENOSINE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10122 == * Synonym(s): == Reactions associated == * NAD+-ADP-RIBOSYLTRANSFERASE-RXN ** in-silico_annotation ***ec-number == Pathways a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-96 CPD1F-96] == |
+ | * smiles: | ||
+ | ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L | ||
+ | * common name: | ||
+ | ** gibberellin A19 | ||
+ | * molecular weight: | ||
+ | ** 360.406 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA19 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN1F-169]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN1F-168]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200921 25200921] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58587 58587] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02034 C02034] | ||
+ | * HMDB : HMDB36896 | ||
+ | {{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L}} | ||
+ | {{#set: common name=gibberellin A19}} | ||
+ | {{#set: molecular weight=360.406 }} | ||
+ | {{#set: common name=GA19}} | ||
+ | {{#set: consumed by=RXN1F-169}} | ||
+ | {{#set: produced by=RXN1F-168}} |
Revision as of 19:55, 18 March 2018
Contents
Metabolite CPD1F-96
- smiles:
- C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=VNCQCPQAMDQEBY-YTJHIPEWSA-L
- common name:
- gibberellin A19
- molecular weight:
- 360.406
- Synonym(s):
- GA19
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.