Difference between revisions of "Jasmonic-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14568 == * left end position: ** 3430 * transcription direction: ** NEGATIVE * right end position: ** 5471 * centisome position: ** 61.6795...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_14568 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] ==
* left end position:
+
* smiles:
** 3430
+
** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
* right end position:
+
* common name:
** 5471
+
** oleanolate
* centisome position:
+
* molecular weight:
** 61.679554    
+
** 455.699    
 
* Synonym(s):
 
* Synonym(s):
 +
** oleanolic acid
 +
** oleanic acid
 +
** caryophyllin
 +
** 3-beta-Hydroxyolean-12-en-28-oic acid
 +
** oleonolic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[F16ALDOLASE-RXN]]
+
* [[RXN-9000]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-8631]]
+
** in-silico_annotation
+
***ec-number
+
** experimental_annotation
+
***ec-number
+
** [[pantograph]]-[[esiliculosus]]
+
* [[SEDOBISALDOL-RXN]]
+
** [[pantograph]]-[[synechocystis]]
+
== Pathways associated ==
+
* [[PWY-1042]]
+
* [[P341-PWY]]
+
* [[PWY66-373]]
+
* [[GLUCONEO-PWY]]
+
* [[GLYCOLYSIS]]
+
* [[SUCSYN-PWY]]
+
* [[PWY-7385]]
+
* [[ANAGLYCOLYSIS-PWY]]
+
* [[CALVIN-PWY]]
+
* [[PWY0-1517]]
+
* [[PWY-1861]]
+
* [[PWY-6142]]
+
* [[PWY-5484]]
+
* [[P185-PWY]]
+
* [[PWY66-399]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3430}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404]
{{#set: right end position=5471}}
+
* CHEMSPIDER:
{{#set: centisome position=61.679554   }}
+
** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737]
{{#set: reaction associated=F16ALDOLASE-RXN|RXN-8631|SEDOBISALDOL-RXN}}
+
* CHEBI:
{{#set: pathway associated=PWY-1042|P341-PWY|PWY66-373|GLUCONEO-PWY|GLYCOLYSIS|SUCSYN-PWY|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|PWY66-399}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828]
 +
* METABOLIGHTS : MTBLC37659
 +
* HMDB : HMDB02364
 +
{{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}}
 +
{{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}}
 +
{{#set: common name=oleanolate}}
 +
{{#set: molecular weight=455.699   }}
 +
{{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}}
 +
{{#set: consumed by=RXN-9000}}

Revision as of 18:55, 18 March 2018

Metabolite CPD-9459

  • smiles:
    • CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
  • inchi key:
    • InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
  • common name:
    • oleanolate
  • molecular weight:
    • 455.699
  • Synonym(s):
    • oleanolic acid
    • oleanic acid
    • caryophyllin
    • 3-beta-Hydroxyolean-12-en-28-oic acid
    • oleonolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C" cannot be used as a page name in this wiki.