Difference between revisions of "MALEATE"

Revision as of 18:55, 18 March 2018

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] ==
+* smiles:
+** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))
+* inchi key:
+** InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M
 * common name:
-** an unwound RNA
+** tetraiodothyroacetate
+* molecular weight:
+** 746.825
 * Synonym(s):
+** Tetrac
+** tetraiodothyroacetic acid
+** TA4
 == Reaction(s) known to consume the compound ==
+* [[RXN-10616]]
+* [[RXN-10617]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-11109]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=an unwound RNA}}
+* PUBCHEM:
-{{#set: produced by=RXN-11109}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237272 44237272]
+{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2))}}
+{{#set: inchi key=InChIKey=PPJYSSNKSXAVDB-UHFFFAOYSA-M}}
+{{#set: common name=tetraiodothyroacetate}}
+{{#set: molecular weight=746.825    }}
+{{#set: common name=Tetrac|tetraiodothyroacetic acid|TA4}}
+{{#set: consumed by=RXN-10616|RXN-10617}}