Difference between revisions of "CELLULOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UBIQUITIN-THIOLESTERASE-RXN UBIQUITIN-THIOLESTERASE-RXN] == * direction: ** LEFT-TO-RIGHT * Synonym...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UBIQUITIN-THIOLESTERASE-RXN UBIQUITIN-THIOLESTERASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
 +
* inchi key:
 +
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
 +
* common name:
 +
** 24-methylenecycloartanol
 +
* molecular weight:
 +
** 440.751   
 
* Synonym(s):
 
* Synonym(s):
 +
** 24(28)-methylenecycloartanol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[Ubiquitin-C-terminal-thioesters]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[Ubiquitins]][c] '''+''' 1.0 [[Thiols]][c]
+
* [[RXN-4021]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 a ubiquitin C-terminal thioester[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 a ubiquitin[c] '''+''' 1.0 a thiol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9986]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_14310]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_16450]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_19804]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_11533]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_8650]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_7260]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_9986|Tiso_gene_14310|Tiso_gene_16450|Tiso_gene_19804|Tiso_gene_11533|Tiso_gene_8650|Tiso_gene_7260}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
 +
{{#set: common name=24-methylenecycloartanol}}
 +
{{#set: molecular weight=440.751    }}
 +
{{#set: common name=24(28)-methylenecycloartanol}}
 +
{{#set: produced by=RXN-4021}}

Revision as of 19:55, 18 March 2018

Metabolite CPD-696

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
  • common name:
    • 24-methylenecycloartanol
  • molecular weight:
    • 440.751
  • Synonym(s):
    • 24(28)-methylenecycloartanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CELLULOSE&oldid=27802"