Difference between revisions of "1-2-Diglycerides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12861 RXN-12861] == * direction: ** LEFT-TO-RIGHT * common name: ** dehydroascorbate hydrolase...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12861 RXN-12861] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
 +
* inchi key:
 +
** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
 
* common name:
 
* common name:
−
** dehydroascorbate hydrolase
+
** (3Z)-phycoerythrobilin
 +
* molecular weight:
 +
** 584.671   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-13907]][c] '''=>''' 1 [[CPD-334]][c] '''+''' 1 [[PROTON]][c]
+
* [[1.3.7.3-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 dehydroascorbate (bicyclic form)[c] '''=>''' 1 2,3-dioxo-L-gulonate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-6961]], L-ascorbate degradation II (bacterial, aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=dehydroascorbate hydrolase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182]
−
{{#set: in pathway=PWY-6959|PWY-6961}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}}
 +
{{#set: common name=(3Z)-phycoerythrobilin}}
 +
{{#set: molecular weight=584.671    }}
 +
{{#set: produced by=1.3.7.3-RXN}}

Revision as of 18:55, 18 March 2018

Metabolite 3Z-PHYCOERYTHROBILIN

  • smiles:
    • CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
  • inchi key:
    • InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
  • common name:
    • (3Z)-phycoerythrobilin
  • molecular weight:
    • 584.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1-2-Diglycerides&oldid=27844"