Difference between revisions of "DCYTPT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-607 RXN1G-607] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta1...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-607 RXN1G-607] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(=CNC2(=C1C=C(O)C(O)=C2))
 +
* inchi key:
 +
** InChIKey=SGNZYJXNUURYCH-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase
+
** 5,6-dihydroxyindole
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** 149.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** 1H-indole-5,6-diol
 +
** dopamine lutine
 +
** DHI
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[trans-D2-cis-cis-D15-27-C46-3-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[cis-cis-D15-27-C46-2-ACPs]][c] '''+''' 1 [[NAD]][c]
+
* [[RXN-11403]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a trans-delta2-cis,cis-delta15,27-C46:3-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 a cis,cis-delta15,27-C46:2-[acp][c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB01811
−
{{#set: common name=trans-delta2-cis,cis-delta15,27-C46:3-[acyl-carrier protein] reductase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.3.1.M4}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=114683 114683]
−
{{#set: gene associated=Tiso_gene_10778}}
+
* HMDB : HMDB04058
−
{{#set: in pathway=PWYG-321}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05578 C05578]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.chemspider.com/Chemical-Structure.102690.html 102690]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27404 27404]
 +
{{#set: smiles=C1(=CNC2(=C1C=C(O)C(O)=C2))}}
 +
{{#set: inchi key=InChIKey=SGNZYJXNUURYCH-UHFFFAOYSA-N}}
 +
{{#set: common name=5,6-dihydroxyindole}}
 +
{{#set: molecular weight=149.149    }}
 +
{{#set: common name=1H-indole-5,6-diol|dopamine lutine|DHI}}
 +
{{#set: produced by=RXN-11403}}

Revision as of 18:56, 18 March 2018

Metabolite DIHYDROXYINDOLE

  • smiles:
    • C1(=CNC2(=C1C=C(O)C(O)=C2))
  • inchi key:
    • InChIKey=SGNZYJXNUURYCH-UHFFFAOYSA-N
  • common name:
    • 5,6-dihydroxyindole
  • molecular weight:
    • 149.149
  • Synonym(s):
    • 1H-indole-5,6-diol
    • dopamine lutine
    • DHI

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCYTPT&oldid=27883"