Difference between revisions of "Tiso gene 572"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19413 == * left end position: ** 867 * transcription direction: ** POSITIVE * right end position: ** 2300 * centisome position: ** 37.06712...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == |
− | * | + | * smiles: |
− | ** | + | ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M |
− | * | + | * common name: |
− | ** | + | ** primary fluorescent chlorophyll catabolite |
− | * | + | * molecular weight: |
− | ** | + | ** 626.708 |
* Synonym(s): | * Synonym(s): | ||
+ | ** pFCC | ||
+ | ** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-7741]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719] |
− | {{#set: | + | {{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}} |
+ | {{#set: common name=primary fluorescent chlorophyll catabolite}} | ||
+ | {{#set: molecular weight=626.708 }} | ||
+ | {{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}} | ||
+ | {{#set: produced by=RXN-7741}} |
Revision as of 18:56, 18 March 2018
Contents
Metabolite CPD-7064
- smiles:
- CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
- inchi key:
- InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
- common name:
- primary fluorescent chlorophyll catabolite
- molecular weight:
- 626.708
- Synonym(s):
- pFCC
- (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)" cannot be used as a page name in this wiki.