Difference between revisions of "Tiso gene 16181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9914 == * left end position: ** 796 * transcription direction: ** NEGATIVE * right end position: ** 2894 * centisome position: ** 8.8671055...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_9914 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
−
* left end position:
+
* smiles:
−
** 796
+
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
−
* right end position:
+
* common name:
−
** 2894
+
** betanidin
−
* centisome position:
+
* molecular weight:
−
** 8.8671055    
+
** 386.317    
 
* Synonym(s):
 
* Synonym(s):
 +
** betanidin radical
 +
** 2,6-Pyridinedicarboxylic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PRPPAMIDOTRANS-RXN]]
+
* [[RXN-8635]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways associated ==
+
−
* [[PWY-6121]]
+
−
* [[PWY-6122]]
+
−
* [[PWY-7282]]
+
−
* [[PWY-6277]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=796}}
+
* DRUGBANK : DB00217
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=2894}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
−
{{#set: centisome position=8.8671055   }}
+
* CHEBI:
−
{{#set: reaction associated=PRPPAMIDOTRANS-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
−
{{#set: pathway associated=PWY-6121|PWY-6122|PWY-7282|PWY-6277}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
 +
* HMDB : HMDB29407
 +
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
 +
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
 +
{{#set: common name=betanidin}}
 +
{{#set: molecular weight=386.317   }}
 +
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
 +
{{#set: consumed by=RXN-8635}}

Revision as of 18:56, 18 March 2018

Metabolite CPD-8653

  • smiles:
    • C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
  • inchi key:
    • InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
  • common name:
    • betanidin
  • molecular weight:
    • 386.317
  • Synonym(s):
    • betanidin radical
    • 2,6-Pyridinedicarboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16181&oldid=27913"