Difference between revisions of "Tiso gene 7286"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20054 == * left end position: ** 8 * transcription direction: ** POSITIVE * right end position: ** 723 * centisome position: ** 0.44469148...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 5-hydroxytryptophol glucuronide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 353.328 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10784]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086] | |
| − | {{#set: | + | {{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=5-hydroxytryptophol glucuronide}} |
| − | {{#set: | + | {{#set: molecular weight=353.328 }} |
| − | {{#set: | + | {{#set: produced by=RXN-10784}} |
Revision as of 18:56, 18 March 2018
Contents
Metabolite CPD-11673
- smiles:
- C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
- inchi key:
- InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
- common name:
- 5-hydroxytryptophol glucuronide
- molecular weight:
- 353.328
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
