Difference between revisions of "Tiso gene 10069"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15181 == * left end position: ** 302 * transcription direction: ** POSITIVE * right end position: ** 1763 * centisome position: ** 5.817761...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=WSALICWLARPULC-GJYKHRJNSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-oxo-tetracosatetraenoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1120.05 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA | ||
+ | ** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-17109]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581124 71581124] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73857 73857] |
− | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
+ | {{#set: inchi key=InChIKey=WSALICWLARPULC-GJYKHRJNSA-J}} | ||
+ | {{#set: common name=3-oxo-tetracosatetraenoyl-CoA}} | ||
+ | {{#set: molecular weight=1120.05 }} | ||
+ | {{#set: common name=3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA|3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}} | ||
+ | {{#set: consumed by=RXN-17109}} |
Revision as of 19:57, 18 March 2018
Contents
Metabolite CPD-17329
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=WSALICWLARPULC-GJYKHRJNSA-J
- common name:
- 3-oxo-tetracosatetraenoyl-CoA
- molecular weight:
- 1120.05
- Synonym(s):
- 3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
- 3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.