Difference between revisions of "Red-Thioredoxin"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-148 RXN1F-148] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L |
| + | * common name: | ||
| + | ** β-L-galactose 1-phosphate | ||
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXNQT-4142]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728461 71728461] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75522 75522] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15926 C15926] | |
| − | {{#set: | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L}} |
| − | {{#set: | + | {{#set: common name=β-L-galactose 1-phosphate}} |
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: consumed by=RXNQT-4142}} | ||
Revision as of 18:57, 18 March 2018
Contents
Metabolite CPDQT-4
- smiles:
- C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-SXUWKVJYSA-L
- common name:
- β-L-galactose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1)" cannot be used as a page name in this wiki.
