Difference between revisions of "Tiso gene 3651"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] == * direction: ** LEFT-TO-RIGHT * common name: ** cyanase * Synonym(s): ** cy...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5222 RXN0-5222] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
 
* common name:
 
* common name:
−
** cyanase
+
** myosin light-chain phosphate
 
* Synonym(s):
 
* Synonym(s):
−
** cyanate lyase
 
−
** cyanate hydrolase
 
−
** cyanate aminohydrolase
 
−
** cyanate C-N-lyase
 
−
** cyanate hydratase
 
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CARBAMATE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[AMMONIUM]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[2.7.11.18-RXN]]
−
** 1 carbamate[c] '''+''' 2 H+[c] '''=>''' 1 CO2[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[CYANCAT-PWY]], cyanate degradation: [http://metacyc.org/META/NEW-IMAGE?object=CYANCAT-PWY CYANCAT-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY0-1471]], uracil degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1471 PWY0-1471]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIGAND-CPD:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15649 15649]
+
** [http://www.genome.jp/dbget-bin/www_bget?C03875 C03875]
−
* LIGAND-RXN:
+
{{#set: smiles=C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07316 R07316]
+
{{#set: common name=myosin light-chain phosphate}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: reversible reaction associated=2.7.11.18-RXN}}
−
{{#set: common name=cyanase}}
+
−
{{#set: common name=cyanate lyase|cyanate hydrolase|cyanate aminohydrolase|cyanate C-N-lyase|cyanate hydratase}}
+
−
{{#set: in pathway=CYANCAT-PWY|PWY0-1471}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Revision as of 18:57, 18 March 2018

Metabolite CPD-8563

  • smiles:
    • C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
  • common name:
    • myosin light-chain phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3651&oldid=27979"