Difference between revisions of "DMPBQ"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-THF-GLU-N FORMYL-THF-GLU-N] == * common name: ** an N10-formyl-tetrahydrofolate * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL CYCLOEUCALENOL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL CYCLOEUCALENOL] == |
| + | * smiles: | ||
| + | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** cycloeucalenol |
| + | * molecular weight: | ||
| + | ** 426.724 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 469-39-6 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515311 102515311] |
| − | {{#set: consumed | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16653 16653] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02141 C02141] | ||
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))}} | ||
| + | {{#set: inchi key=InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N}} | ||
| + | {{#set: common name=cycloeucalenol}} | ||
| + | {{#set: molecular weight=426.724 }} | ||
| + | {{#set: consumed by=CYCLOEUCALENOL-CYCLOISOMERASE-RXN}} | ||
Revision as of 18:57, 18 March 2018
Contents
Metabolite CYCLOEUCALENOL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))
- inchi key:
- InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N
- common name:
- cycloeucalenol
- molecular weight:
- 426.724
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.
