Difference between revisions of "GCLDH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == * smiles: ** C(=CC(=O)[O-])C(O)=CC(=O)[...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=CC(=O)[O-])C(O)=CC(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L |
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxy-cis,cis-muconate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 156.095 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-9922]] |
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729369 54729369] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58139 58139] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03676 C03676] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(=CC(=O)[O-])C(O)=CC(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=3-hydroxy-cis,cis-muconate}} |
| − | {{#set: | + | {{#set: molecular weight=156.095 }} |
| − | + | {{#set: reversible reaction associated=RXN-9922}} | |
| − | + | ||
| − | + | ||
Revision as of 18:57, 18 March 2018
Contents
Metabolite 3-HYDROXY-CISCIS-MUCONATE
- smiles:
- C(=CC(=O)[O-])C(O)=CC(=O)[O-]
- inchi key:
- InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L
- common name:
- 3-hydroxy-cis,cis-muconate
- molecular weight:
- 156.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(O)=CC(=O)[O-" cannot be used as a page name in this wiki.
