Difference between revisions of "RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40."
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Arginines Protein-L-Arginines] == * common name: ** a [protein]-L-arginine * Synonym(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Arginines Protein-L-Arginines] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [protein]-L-arginine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** protein-L-arginine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PROTEIN-ARGININE-DEIMINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.4.2.31-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [protein]-L-arginine}} | |
− | + | {{#set: common name=protein-L-arginine}} | |
− | + | {{#set: consumed by=PROTEIN-ARGININE-DEIMINASE-RXN}} | |
− | + | {{#set: reversible reaction associated=2.4.2.31-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 18:57, 18 March 2018
Contents
Metabolite Protein-L-Arginines
- common name:
- a [protein]-L-arginine
- Synonym(s):
- protein-L-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-arginine" cannot be used as a page name in this wiki.