Difference between revisions of "RXNQT-4366"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] == * common name: ** an aldehyde * Synonym(s): ** aldehyde ** RCHO == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldehydes Aldehydes] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an aldehyde |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** aldehyde | ||
+ | ** RCHO | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]] |
+ | * [[ALDHDEHYDROG-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AMINEOXID-RXN]] | ||
+ | * [[RXN-9597]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[ALCOHOL-DEHYDROG-GENERIC-RXN]] |
+ | * [[ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: common name=an aldehyde}} |
− | {{#set: | + | {{#set: common name=aldehyde|RCHO}} |
− | {{#set: | + | {{#set: consumed by=ALDEHYDE-DEHYDROGENASE-NADP+-RXN|ALDHDEHYDROG-RXN}} |
− | {{#set: | + | {{#set: produced by=AMINEOXID-RXN|RXN-9597}} |
− | + | {{#set: reversible reaction associated=ALCOHOL-DEHYDROG-GENERIC-RXN|ALDEHYDE-DEHYDROGENASE-NADORNOP+-RXN}} | |
− | {{#set: | + |
Revision as of 18:58, 18 March 2018
Contents
Metabolite Aldehydes
- common name:
- an aldehyde
- Synonym(s):
- aldehyde
- RCHO