Difference between revisions of "Tiso gene 5563"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-1281 RXN0-1281] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydrouridine synthase **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == * smiles: ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-AMP PHOSPHORIBOSYL-AMP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 1-(5-phospho-β-D-ribosyl)-AMP |
− | + | * molecular weight: | |
− | * | + | ** 555.288 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-(5-phosphoribosyl)-AMP | ||
+ | ** phosphoribosyl-AMP | ||
+ | ** 5-phosphoribosyl-AMP | ||
+ | ** N-(5-phospho-D-ribosyl)-AMP | ||
+ | ** N-(5'-phospho-D-ribosyl)-AMP | ||
+ | ** N1-(5-phospho-D-ribosyl)-AMP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[HISTCYCLOHYD-RXN]] |
− | + | * [[PRACH]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[HISTPRATPHYD-RXN]] | |
− | + | * [[PRADP]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02741 C02741] | |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59457 59457] | |
− | + | * BIGG : prbamp | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480652 45480652] |
− | {{#set: | + | * HMDB : HMDB12276 |
− | {{#set: | + | {{#set: smiles=C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J}} |
− | {{#set: | + | {{#set: common name=1-(5-phospho-β-D-ribosyl)-AMP}} |
− | {{#set: | + | {{#set: molecular weight=555.288 }} |
+ | {{#set: common name=1-(5-phosphoribosyl)-AMP|phosphoribosyl-AMP|5-phosphoribosyl-AMP|N-(5-phospho-D-ribosyl)-AMP|N-(5'-phospho-D-ribosyl)-AMP|N1-(5-phospho-D-ribosyl)-AMP}} | ||
+ | {{#set: consumed by=HISTCYCLOHYD-RXN|PRACH}} | ||
+ | {{#set: produced by=HISTPRATPHYD-RXN|PRADP}} |
Revision as of 19:58, 18 March 2018
Contents
Metabolite PHOSPHORIBOSYL-AMP
- smiles:
- C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=RTQMRTSPTLIIHM-KEOHHSTQSA-J
- common name:
- 1-(5-phospho-β-D-ribosyl)-AMP
- molecular weight:
- 555.288
- Synonym(s):
- 1-(5-phosphoribosyl)-AMP
- phosphoribosyl-AMP
- 5-phosphoribosyl-AMP
- N-(5-phospho-D-ribosyl)-AMP
- N-(5'-phospho-D-ribosyl)-AMP
- N1-(5-phospho-D-ribosyl)-AMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C4(C(C(C(N3(C(C2(=C(N(C1(C(C(C(O1)COP([O-])(=O)[O-])O)O))C=N2)N=C3))=N))O4)O)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.