Difference between revisions of "RXN-16154"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] == * direction: ** LEFT-TO-RIGHT * common name: ** N,N'-diacetylchitobiose &be...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == * smiles: ** C(O)C1(C(O)C(O)C(O)O1) * inchi key: ** InChIKey=HMFHBZSHGG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12045 CPD-12045] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(O)O1) |
| + | * inchi key: | ||
| + | ** InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** α-L-arabinofuranose |
| − | * | + | * molecular weight: |
| − | + | ** 150.131 | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** α-L-arabinose | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[3.2.1.55-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * DRUGBANK : DB03142 |
| − | ** [http:// | + | * PUBCHEM: |
| − | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445935 445935] |
| − | ** [http://www. | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.393416.html 393416] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28772 28772] |
| − | {{#set: | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)O1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N}} |
| − | + | {{#set: common name=α-L-arabinofuranose}} | |
| − | {{#set: | + | {{#set: molecular weight=150.131 }} |
| − | + | {{#set: common name=α-L-arabinose}} | |
| − | + | {{#set: produced by=3.2.1.55-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 18:58, 18 March 2018
Contents
Metabolite CPD-12045
- smiles:
- C(O)C1(C(O)C(O)C(O)O1)
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-QMKXCQHVSA-N
- common name:
- α-L-arabinofuranose
- molecular weight:
- 150.131
- Synonym(s):
- α-L-arabinose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
