Difference between revisions of "Delta4-hexadecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6216 == * left end position: ** 9697 * transcription direction: ** POSITIVE * right end position: ** 12238 * centisome position: ** 77.9313...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6216 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
−
* left end position:
+
* smiles:
−
** 9697
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
−
* right end position:
+
* common name:
−
** 12238
+
** gibberellin A8
−
* centisome position:
+
* molecular weight:
−
** 77.931366    
+
** 363.386    
 
* Synonym(s):
 
* Synonym(s):
 +
** GA8
 +
** 2β-hydroxygibberellin 1
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.7.11.18-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** experimental_annotation
+
* [[RXN-115]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[PROTEIN-KINASE-RXN]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=9697}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
−
{{#set: right end position=12238}}
+
* CHEBI:
−
{{#set: centisome position=77.931366   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
−
{{#set: reaction associated=2.7.11.18-RXN|PROTEIN-KINASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
 +
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
 +
{{#set: common name=gibberellin A8}}
 +
{{#set: molecular weight=363.386   }}
 +
{{#set: common name=GA8|2β-hydroxygibberellin 1}}
 +
{{#set: produced by=RXN-115}}

Revision as of 18:59, 18 March 2018

Metabolite CPD-204

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
  • common name:
    • gibberellin A8
  • molecular weight:
    • 363.386
  • Synonym(s):
    • GA8
    • 2β-hydroxygibberellin 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Delta4-hexadecenoyl-ACPs&oldid=28120"