Difference between revisions of "Tiso gene 11824"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] == * common name: ** an aldose * Synonym(s): ** an aldose == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] ==
* smiles:
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
* inchi key:
+
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
+
 
* common name:
 
* common name:
** 24-methylenecycloartanol
+
** an aldose
* molecular weight:
+
** 440.751   
+
 
* Synonym(s):
 
* Synonym(s):
** 24(28)-methylenecycloartanol
+
** an aldose
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4021]]
+
* [[RXN-9926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ALDEHYDE-REDUCTASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an aldose}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981]
+
{{#set: common name=an aldose}}
* LIGAND-CPD:
+
{{#set: produced by=RXN-9926}}
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
+
{{#set: reversible reaction associated=ALDEHYDE-REDUCTASE-RXN}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
+
{{#set: common name=24-methylenecycloartanol}}
+
{{#set: molecular weight=440.751    }}
+
{{#set: common name=24(28)-methylenecycloartanol}}
+
{{#set: produced by=RXN-4021}}
+

Revision as of 18:59, 18 March 2018

Metabolite Aldoses

  • common name:
    • an aldose
  • Synonym(s):
    • an aldose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links