Difference between revisions of "CPD1F-137"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11824 == * left end position: ** 3821 * transcription direction: ** NEGATIVE * right end position: ** 6117 * centisome position: ** 50.9942...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == |
| − | * | + | * smiles: |
| − | ** | + | ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 3-(7'-methylthio)heptylmalate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 276.347 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-(7'-methylthio)heptylmalic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXNQT-4178]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | * [[RXN-18200]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172] |
| − | {{#set: | + | {{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}} |
| − | {{#set: | + | {{#set: common name=3-(7'-methylthio)heptylmalate}} |
| − | {{#set: | + | {{#set: molecular weight=276.347 }} |
| + | {{#set: common name=3-(7'-methylthio)heptylmalic acid}} | ||
| + | {{#set: consumed by=RXNQT-4178}} | ||
| + | {{#set: reversible reaction associated=RXN-18200}} | ||
Revision as of 19:59, 18 March 2018
Contents
Metabolite CPDQT-40
- smiles:
- CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
- common name:
- 3-(7'-methylthio)heptylmalate
- molecular weight:
- 276.347
- Synonym(s):
- 3-(7'-methylthio)heptylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.
