Difference between revisions of "GDPA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTURONATE FRUCTURONATE] == * common name: ** D-fructuronate * Synonym(s): ** fructuronate =...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTURONATE FRUCTURONATE] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** D- | + | ** D-fructuronate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** fructuronate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[GLUCUROISOM-RXN]] |
== External links == | == External links == | ||
− | + | {{#set: common name=D-fructuronate}} | |
− | + | {{#set: common name=fructuronate}} | |
− | + | {{#set: reversible reaction associated=GLUCUROISOM-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name=D- | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 20:00, 18 March 2018
Contents
Metabolite FRUCTURONATE
- common name:
- D-fructuronate
- Synonym(s):
- fructuronate