Difference between revisions of "RXN-17917"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * smiles: ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == |
* smiles: | * smiles: | ||
| − | ** CC(= | + | ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J |
* common name: | * common name: | ||
| − | ** | + | ** acryloyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 817.551 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** acrylyl-coenzyme A |
| − | ** | + | ** propenoyl-CoA |
| − | ** | + | ** acrylyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[PPCOAOm]] |
| + | * [[RXN-6383]] | ||
== External links == | == External links == | ||
| + | * CAS : 5776-58-9 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595] |
| − | * | + | * HMDB : HMDB02307 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles=CC(= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367] |
| − | {{#set: inchi key=InChIKey= | + | * METABOLIGHTS : MTBLC57367 |
| − | {{#set: common name= | + | {{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=acryloyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=817.551 }} |
| − | + | {{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}} | |
| − | + | {{#set: reversible reaction associated=PPCOAOm|RXN-6383}} | |
Revision as of 19:00, 18 March 2018
Contents
Metabolite ACRYLYL-COA
- smiles:
- C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
- common name:
- acryloyl-CoA
- molecular weight:
- 817.551
- Synonym(s):
- acrylyl-coenzyme A
- propenoyl-CoA
- acrylyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 5776-58-9
- PUBCHEM:
- HMDB : HMDB02307
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57367
"C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
