Difference between revisions of "Tiso gene 8816"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14249 == * left end position: ** 21 * transcription direction: ** NEGATIVE * right end position: ** 2054 * centisome position: ** 0.1932989...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N |
− | * | + | * common name: |
− | ** | + | ** trans-3'-hydroxycotinine |
− | * | + | * molecular weight: |
− | ** | + | ** 192.217 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN66-162]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-161]] | |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=107963 107963] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.97080.html 97080] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71182 71182] | ||
+ | * METABOLIGHTS : MTBLC71182 | ||
+ | * HMDB : HMDB01390 | ||
+ | {{#set: smiles=C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))}} | ||
+ | {{#set: inchi key=InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N}} | ||
+ | {{#set: common name=trans-3'-hydroxycotinine}} | ||
+ | {{#set: molecular weight=192.217 }} | ||
+ | {{#set: consumed by=RXN66-162}} | ||
+ | {{#set: produced by=RXN66-161}} |
Revision as of 20:00, 18 March 2018
Contents
Metabolite CPD-2750
- smiles:
- C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))
- inchi key:
- InChIKey=XOKCJXZZNAUIQN-DTWKUNHWSA-N
- common name:
- trans-3'-hydroxycotinine
- molecular weight:
- 192.217
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.