Difference between revisions of "Tiso gene 12326"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPYRROLINEDEH-RXN HYDROXYPYRROLINEDEH-RXN] == * direction: ** REVERSIBLE * common name: ** py...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-4-HYDROXY-2-KETO-GLUTARATE D-4-HYDROXY-2-KETO-GLUTARATE] == * smiles: ** C(C(=O)C([O-])=O)C(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-4-HYDROXY-2-KETO-GLUTARATE D-4-HYDROXY-2-KETO-GLUTARATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(=O)C([O-])=O)C(C([O-])=O)O |
+ | * inchi key: | ||
+ | ** InChIKey=WXSKVKPSMAHCSG-UWTATZPHSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** (4R)-4-hydroxy-2-oxoglutarate |
− | * | + | * molecular weight: |
− | ** | + | ** 160.083 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-4-hydroxy-2-ketoglutarate | ||
+ | ** (R)-2-hydroxy-4-oxopentanedioate | ||
+ | ** D-4-hydroxy-2-oxoglutarate | ||
+ | ** D-4-hydroxy-2-keto-glutarate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[R00471]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05946 C05946] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62213 62213] | |
− | {{#set: | + | * METABOLIGHTS : MTBLC62213 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52921639 52921639] |
− | {{#set: | + | * HMDB : HMDB60466 |
− | {{#set: | + | {{#set: smiles=C(C(=O)C([O-])=O)C(C([O-])=O)O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WXSKVKPSMAHCSG-UWTATZPHSA-L}} |
+ | {{#set: common name=(4R)-4-hydroxy-2-oxoglutarate}} | ||
+ | {{#set: molecular weight=160.083 }} | ||
+ | {{#set: common name=D-4-hydroxy-2-ketoglutarate|(R)-2-hydroxy-4-oxopentanedioate|D-4-hydroxy-2-oxoglutarate|D-4-hydroxy-2-keto-glutarate}} | ||
+ | {{#set: consumed by=R00471}} |
Revision as of 19:00, 18 March 2018
Contents
Metabolite D-4-HYDROXY-2-KETO-GLUTARATE
- smiles:
- C(C(=O)C([O-])=O)C(C([O-])=O)O
- inchi key:
- InChIKey=WXSKVKPSMAHCSG-UWTATZPHSA-L
- common name:
- (4R)-4-hydroxy-2-oxoglutarate
- molecular weight:
- 160.083
- Synonym(s):
- D-4-hydroxy-2-ketoglutarate
- (R)-2-hydroxy-4-oxopentanedioate
- D-4-hydroxy-2-oxoglutarate
- D-4-hydroxy-2-keto-glutarate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.