Difference between revisions of "RXN-10706"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1369 == * left end position: ** 19332 * transcription direction: ** POSITIVE * right end position: ** 23172 * centisome position: ** 80.395...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M |
| − | * | + | * common name: |
| − | ** | + | ** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 362.42 |
* Synonym(s): | * Synonym(s): | ||
| + | ** ACV | ||
| + | ** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine | ||
| + | ** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine | ||
| + | ** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.21.3.1-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556] |
| + | {{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}} | ||
| + | {{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}} | ||
| + | {{#set: molecular weight=362.42 }} | ||
| + | {{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}} | ||
| + | {{#set: consumed by=1.21.3.1-RXN}} | ||
Revision as of 19:00, 18 March 2018
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- smiles:
- CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
- inchi key:
- InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
- common name:
- N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
- molecular weight:
- 362.42
- Synonym(s):
- ACV
- L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
- δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
- N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-" cannot be used as a page name in this wiki.
"N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
"N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
