Difference between revisions of "CPD1G-1353"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == |
* smiles: | * smiles: | ||
− | ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M |
* common name: | * common name: | ||
− | ** gibberellin | + | ** gibberellin A1 |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 347.387 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GA1 |
+ | ** gibberellin 1 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-115]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} |
− | {{#set: common name=gibberellin | + | {{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}} |
− | {{#set: molecular weight= | + | {{#set: common name=gibberellin A1}} |
− | {{#set: common name= | + | {{#set: molecular weight=347.387 }} |
− | {{#set: consumed by=RXN- | + | {{#set: common name=GA1|gibberellin 1}} |
− | + | {{#set: consumed by=RXN-115}} |
Revision as of 20:00, 18 March 2018
Contents
Metabolite CPD1F-139
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- inchi key:
- InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
- common name:
- gibberellin A1
- molecular weight:
- 347.387
- Synonym(s):
- GA1
- gibberellin 1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.