Difference between revisions of "RXN-18229"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http://en...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
 
* common name:
 
* common name:
−
** ORF
+
** campestanol
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
+
** 402.702   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-campestanol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-773]]
−
** 2 [[WATER]][c] '''+''' 1 [[CPD0-1905]][c] '''<=>''' 2 [[PROTON]][c] '''+''' 1 [[CPD-12365]][c] '''+''' 2 [[Pi]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H2O[c] '''+''' 1 8-oxo-dGTP[c] '''<=>''' 2 H+[c] '''+''' 1 8-oxo-dGMP[c] '''+''' 2 phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12899]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_20236]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=ORF}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394]
−
{{#set: ec number=EC-3.6.1.5}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=campestanol}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=402.702    }}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=5&alpha;-campestanol}}
 +
{{#set: consumed by=RXN-773}}

Revision as of 19:00, 18 March 2018

Metabolite CPD-710

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
  • common name:
    • campestanol
  • molecular weight:
    • 402.702
  • Synonym(s):
    • 5α-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-18229&oldid=28237"