Difference between revisions of "Tiso gene 11786"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5182 RXN0-5182] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5182 RXN0-5182] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
 
* common name:
 
* common name:
−
** thymidine_phosphorylase
+
** Mg-protoporphyrin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
** 582.94   
 
* Synonym(s):
 
* Synonym(s):
 +
** Mg-protoporphyrin IX
 +
** magnesium protoporphyrin
 +
** MgP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
−
** 1 [[Pi]][c] '''+''' 1 [[MALTOTETRAOSE]][c] '''=>''' 1 [[MALTOTRIOSE]][c] '''+''' 1 [[GLC-1-P]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-20]]
−
** 1 phosphate[c] '''+''' 1 maltotetraose[c] '''=>''' 1 maltotriose[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1011]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
+
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29691 29691]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=thymidine_phosphorylase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
−
{{#set: ec number=EC-2.4.1.1}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Tiso_gene_1011}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
−
{{#set: in pathway=GLYCOCAT-PWY}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=Mg-protoporphyrin}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=582.94    }}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
 +
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
 +
{{#set: produced by=RXN1F-20}}

Revision as of 19:00, 18 March 2018

Metabolite MG-PROTOPORPHYRIN

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
  • common name:
    • Mg-protoporphyrin
  • molecular weight:
    • 582.94
  • Synonym(s):
    • Mg-protoporphyrin IX
    • magnesium protoporphyrin
    • MgP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11786&oldid=28253"