Difference between revisions of "RXN-11667"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4497 == * Synonym(s): == Reactions associated == * ACID-PHOSPHATASE-RXN ** pantograph-esiliculosus * RXNQT-4191 ** panto...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == |
+ | * smiles: | ||
+ | ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N | ||
+ | * common name: | ||
+ | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin | ||
+ | * molecular weight: | ||
+ | ** 223.234 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-15733]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658804 90658804] |
+ | {{#set: smiles=CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))}} | ||
+ | {{#set: inchi key=InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N}} | ||
+ | {{#set: common name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} | ||
+ | {{#set: molecular weight=223.234 }} | ||
+ | {{#set: consumed by=RXN-15733}} |
Revision as of 19:00, 18 March 2018
Contents
Metabolite CPD-16953
- smiles:
- CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2))
- inchi key:
- InChIKey=GHRBCDHNYSUFRN-IUYQGCFVSA-N
- common name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- molecular weight:
- 223.234
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" cannot be used as a page name in this wiki.