Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5553 == * Synonym(s): == Reactions associated == * CARNOSINE-SYNTHASE-RXN ** pantograph-creinhardtii == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * inch...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == |
+ | * smiles: | ||
+ | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N | ||
+ | * common name: | ||
+ | ** ent-kaurene | ||
+ | * molecular weight: | ||
+ | ** 272.473 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ent-kaur-16-ene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.14.13.78-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR0104130002 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966109 11966109] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.16737395.html 16737395] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090] | ||
+ | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}} | ||
+ | {{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}} | ||
+ | {{#set: common name=ent-kaurene}} | ||
+ | {{#set: molecular weight=272.473 }} | ||
+ | {{#set: common name=ent-kaur-16-ene}} | ||
+ | {{#set: consumed by=1.14.13.78-RXN}} |
Revision as of 19:01, 18 March 2018
Contents
Metabolite CPD1F-128
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
- inchi key:
- InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
- common name:
- ent-kaurene
- molecular weight:
- 272.473
- Synonym(s):
- ent-kaur-16-ene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.