Difference between revisions of "RXN-14883"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=RUMP-PWY RUMP-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** formaldehyde oxidation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''6''' reactions in the full pathway | |
− | * [[ | + | * [[6PGLUCONOLACT-RXN]] |
− | == Reaction(s) | + | ** 5 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_8585]] |
+ | *** [[Tiso_gene_10799]] | ||
+ | *** [[Tiso_gene_20412]] | ||
+ | *** [[Tiso_gene_15950]] | ||
+ | *** [[Tiso_gene_5901]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[GLU6PDEHYDROG-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_16918]] | ||
+ | *** [[Tiso_gene_14877]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[PGLUCISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_19480]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R10-RXN R10-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R12-RXN R12-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3341 RXN-3341] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=formaldehyde oxidation I}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 00:35, 19 March 2018
Pathway RUMP-PWY
- taxonomic range:
- common name:
- formaldehyde oxidation I
- Synonym(s):
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- 6PGLUCONOLACT-RXN
- 5 associated gene(s):
- 6 reconstruction source(s) associated:
- GLU6PDEHYDROG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated: