Difference between revisions of "CPD-14283"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_6705 == * left end position: ** 971 * transcription direction: ** NEGATIVE * right end position: ** 4496 * centisome position: ** 8.14324...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6705 == |
− | * | + | * left end position: |
− | ** | + | ** 971 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4496 |
− | * | + | * centisome position: |
− | ** | + | ** 8.14324 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | * | + | ***ec-number |
− | * [[ | + | ** experimental_annotation |
− | == | + | ***ec-number |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * [[ | + | == Pathways associated == |
− | + | * [[TRNA-CHARGING-PWY]] | |
== External links == | == External links == | ||
− | + | {{#set: left end position=971}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4496}} | |
− | + | {{#set: centisome position=8.14324 }} | |
− | + | {{#set: reaction associated=LYSINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 00:01, 19 March 2018
Gene Tiso_gene_6705
- left end position:
- 971
- transcription direction:
- NEGATIVE
- right end position:
- 4496
- centisome position:
- 8.14324
- Synonym(s):
Reactions associated
- LYSINE--TRNA-LIGASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation