Difference between revisions of "Tiso gene 12190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] == * smiles: ** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_17704 == * left end position: ** 149 * transcription direction: ** POSITIVE * right end position: ** 3028 * centisome position: ** 4.241389...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2472 CPD0-2472] ==
+
== Gene Tiso_gene_17704 ==
−
* smiles:
+
* left end position:
−
** C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)
+
** 149
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (R)-NADHX
+
** 3028
−
* molecular weight:
+
* centisome position:
−
** 681.445    
+
** 4.2413893    
 
* Synonym(s):
 
* Synonym(s):
−
** (6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[HOMOSERKIN-RXN]]
−
* [[RXN-12754]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-702]]
 +
* [[HOMOSER-THRESYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=149}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927860 56927860]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3028}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64075 64075]
+
{{#set: centisome position=4.2413893   }}
−
{{#set: smiles=C1(=C(CCC(O)N1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C(N)=O)}}
+
{{#set: reaction associated=HOMOSERKIN-RXN}}
−
{{#set: inchi key=InChIKey=IDBZKGQRLBFUFQ-MTKBYBFRSA-L}}
+
{{#set: pathway associated=PWY-702|HOMOSER-THRESYN-PWY}}
−
{{#set: common name=(R)-NADHX}}
+
−
{{#set: molecular weight=681.445   }}
+
−
{{#set: common name=(6R)-6-β-hydroxy-1,4,5,6-tetrahydronicotinamide-adenine dinucleotide}}
+
−
{{#set: produced by=RXN-12754}}
+

Revision as of 00:02, 19 March 2018

Gene Tiso_gene_17704

  • left end position:
    • 149
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3028
  • centisome position:
    • 4.2413893
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12190&oldid=28425"