Difference between revisions of "RXN-15068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...")
(Created page with "Category:Gene == Gene Tiso_gene_9914 == * left end position: ** 796 * transcription direction: ** NEGATIVE * right end position: ** 2894 * centisome position: ** 8.8671055...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] ==
+
== Gene Tiso_gene_9914 ==
−
* smiles:
+
* left end position:
−
** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
+
** 796
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** primary fluorescent chlorophyll catabolite
+
** 2894
−
* molecular weight:
+
* centisome position:
−
** 626.708    
+
** 8.8671055    
 
* Synonym(s):
 
* Synonym(s):
−
** pFCC
 
−
** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PRPPAMIDOTRANS-RXN]]
−
* [[RXN-7741]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-6121]]
 +
* [[PWY-6122]]
 +
* [[PWY-7282]]
 +
* [[PWY-6277]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=796}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2894}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719]
+
{{#set: centisome position=8.8671055   }}
−
{{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}}
+
{{#set: reaction associated=PRPPAMIDOTRANS-RXN}}
−
{{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}}
+
{{#set: pathway associated=PWY-6121|PWY-6122|PWY-7282|PWY-6277}}
−
{{#set: common name=primary fluorescent chlorophyll catabolite}}
+
−
{{#set: molecular weight=626.708   }}
+
−
{{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}}
+
−
{{#set: produced by=RXN-7741}}
+

Revision as of 00:03, 19 March 2018

Gene Tiso_gene_9914

  • left end position:
    • 796
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2894
  • centisome position:
    • 8.8671055
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15068&oldid=28455"