Difference between revisions of "Sugar-alcohols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_17517 == * left end position: ** 153 * transcription direction: ** POSITIVE * right end position: ** 2911 * centisome position: ** 4.187192...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17517 == |
− | * | + | * left end position: |
− | ** | + | ** 153 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2911 |
− | * | + | * centisome position: |
− | ** | + | ** 4.187192 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=153}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2911}} | |
− | + | {{#set: centisome position=4.187192 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:03, 19 March 2018
Gene Tiso_gene_17517
- left end position:
- 153
- transcription direction:
- POSITIVE
- right end position:
- 2911
- centisome position:
- 4.187192
- Synonym(s):
Reactions associated
- RXN-15556
- in-silico_annotation
- ec-number
- in-silico_annotation
- UBIQUITIN--PROTEIN-LIGASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation