Difference between revisions of "Tiso gene 8397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-302 CPD-302] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=CKLJMWTZ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine-5'-phosphate phospho...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Pyridoxamine-5'-phosphate phosphohydrolase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[PYRIDOXAMINE-5P]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[PYRIDOXAMINE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1.0 H2O[c] '''+''' 1.0 pyridoxamine 5'-phosphate[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 pyridoxamine[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_18054]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Pyridoxamine-5'-phosphate phosphohydrolase}} | |
− | + | {{#set: gene associated=Tiso_gene_18054}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:03, 19 March 2018
Contents
Reaction PYAMPP
- direction:
- LEFT-TO-RIGHT
- common name:
- Pyridoxamine-5'-phosphate phosphohydrolase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 PYRIDOXAMINE-5P[c] => 1.0 Pi[c] + 1.0 PYRIDOXAMINE[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 pyridoxamine 5'-phosphate[c] => 1.0 phosphate[c] + 1.0 pyridoxamine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii