Difference between revisions of "DCTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidylcholine phospho...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7013 CPD-7013] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** geranylgeranyl chlorophyll b
+
** phosphatidylcholine phospholipase
−
* molecular weight:
+
* ec number:
−
** 901.439   
+
** [http://enzyme.expasy.org/EC/3.1.1 EC-3.1.1]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 2 [[WATER]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[L-1-GLYCERO-PHOSPHORYLCHOLINE]][c] '''+''' 2 [[Carboxylates]][c]
−
* [[RXN-7673]]
+
* With common name(s):
 +
** 2 H2O[c] '''+''' 1 a phosphatidylcholine[c] '''=>''' 2 H+[c] '''+''' 1 sn-glycero-3-phosphocholine[c] '''+''' 2 a carboxylate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15692]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_334]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_2505]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_20565]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7367]], phosphatidylcholine resynthesis via glycerophosphocholine: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7367 PWY-7367]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245917 25245917]
+
{{#set: common name=phosphatidylcholine phospholipase}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C([CH]=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: ec number=EC-3.1.1}}
−
{{#set: common name=geranylgeranyl chlorophyll b}}
+
{{#set: gene associated=Tiso_gene_15692|Tiso_gene_334|Tiso_gene_2505|Tiso_gene_20565}}
−
{{#set: molecular weight=901.439    }}
+
{{#set: in pathway=PWY-7367}}
−
{{#set: consumed or produced by=RXN-7673}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 00:04, 19 March 2018

Reaction RXN-14899

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phosphatidylcholine phospholipase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7367, phosphatidylcholine resynthesis via glycerophosphocholine: PWY-7367
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DCTP&oldid=28539"