Difference between revisions of "RXN-12583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15090 RXN-15090] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-monoacylglycerol acyltran...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15090 RXN-15090] ==
* smiles:
+
* direction:
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
+
 
* common name:
 
* common name:
** dCTP
+
** 2-monoacylglycerol acyltransferase
* molecular weight:
+
* ec number:
** 463.127   
+
** [http://enzyme.expasy.org/EC/2.3.1.22 EC-2.3.1.22]
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxycytidine-5'-triphosphate
 
** deoxycytidine-triphosphate
 
** deoxy-CTP
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14198]]
+
* With identifiers:
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
** 1 [[OLEOYL-COA]][c] '''+''' 1 [[CPD0-1812]][c] '''=>''' 1 [[CPD-15977]][c] '''+''' 1 [[CO-A]][c]
* [[DCTCP]]
+
* With common name(s):
* [[RME255]]
+
** 1 oleoyl-CoA[c] '''+''' 1 2-oleoylglycerol[c] '''=>''' 1 1,2-dioleoylglycerol[c] '''+''' 1 coenzyme A[c]
* [[DCTUP]]
+
 
* [[RXN-14216]]
+
== Genes associated with this reaction  ==
== Reaction(s) known to produce the compound ==
+
== Pathways  ==
* [[ATDCD]]
+
* [[PWY-7420]], monoacylglycerol metabolism (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7420 PWY-7420]
* [[DCDPKIN-RXN]]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
* [[ATDCDm]]
+
== Reconstruction information  ==
== Reaction(s) of unknown directionality ==
+
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 2056-98-6
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=2-monoacylglycerol acyltransferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
+
{{#set: ec number=EC-2.3.1.22}}
* HMDB : HMDB00998
+
{{#set: in pathway=PWY-7420}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
+
* BIGG : dctp
+
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}}
+
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
+
{{#set: common name=dCTP}}
+
{{#set: molecular weight=463.127    }}
+
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
+
{{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}}
+
{{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}}
+

Revision as of 01:04, 19 March 2018

Reaction RXN-15090

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2-monoacylglycerol acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 oleoyl-CoA[c] + 1 2-oleoylglycerol[c] => 1 1,2-dioleoylglycerol[c] + 1 coenzyme A[c]

Genes associated with this reaction

Pathways

  • PWY-7420, monoacylglycerol metabolism (yeast): PWY-7420
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links