Difference between revisions of "3.5.5.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == * smiles: ** COC1(=CC(C=CCO)=CC=C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_16097 == * left end position: ** 181 * transcription direction: ** NEGATIVE * right end position: ** 3932 * centisome position: ** 2.265048...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_16097 == |
− | * | + | * left end position: |
− | ** | + | ** 181 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3932 |
− | * | + | * centisome position: |
− | ** | + | ** 2.2650483 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ASPARTATEKIN-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[HOMOSERSYN-PWY]] | ||
+ | * [[PWY-7153]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2942]] | ||
+ | * [[PWY-2941]] | ||
+ | * [[PWY-6559]] | ||
+ | * [[PWY-5097]] | ||
+ | * [[PWY-6562]] | ||
+ | * [[P101-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=181}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3932}} | |
− | + | {{#set: centisome position=2.2650483 }} | |
− | + | {{#set: reaction associated=ASPARTATEKIN-RXN}} | |
− | + | {{#set: pathway associated=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-5097|PWY-6562|P101-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 00:04, 19 March 2018
Gene Tiso_gene_16097
- left end position:
- 181
- transcription direction:
- NEGATIVE
- right end position:
- 3932
- centisome position:
- 2.2650483
- Synonym(s):
Reactions associated
- ASPARTATEKIN-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation