Difference between revisions of "Tiso gene 3930"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_1682 == * left end position: ** 9336 * transcription direction: ** POSITIVE * right end position: ** 11339 * centisome position: ** 29.8838...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1682 == |
− | * | + | * left end position: |
− | ** | + | ** 9336 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11339 |
− | * | + | * centisome position: |
− | ** | + | ** 29.883808 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN0-2161]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[SERINE--TRNA-LIGASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
+ | * [[PWY0-901]] | ||
+ | * [[PWY-6281]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9336}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11339}} | |
− | + | {{#set: centisome position=29.883808 }} | |
− | + | {{#set: reaction associated=RXN0-2161|SERINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY|PWY0-901|PWY-6281}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:07, 19 March 2018
Gene Tiso_gene_1682
- left end position:
- 9336
- transcription direction:
- POSITIVE
- right end position:
- 11339
- centisome position:
- 29.883808
- Synonym(s):
Reactions associated
- RXN0-2161
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- SERINE--TRNA-LIGASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation