Difference between revisions of "RXN-7580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_13367 == * left end position: ** 478 * transcription direction: ** POSITIVE * right end position: ** 2108 * centisome position: ** 7.531117...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] ==
+
== Gene Tiso_gene_13367 ==
* smiles:
+
* left end position:
** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
** 478
* inchi key:
+
* transcription direction:
** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
+
** POSITIVE
* common name:
+
* right end position:
** UDP-α-D-galactofuranose
+
** 2108
* molecular weight:
+
* centisome position:
** 564.289    
+
** 7.531117    
 
* Synonym(s):
 
* Synonym(s):
** UDP-Galf
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[1.3.99.23-RXN]]
== Reaction(s) of unknown directionality ==
+
** in-silico_annotation
* [[GALPMUT-RXN]]
+
***ec-number
 +
* [[RXN-8042]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6475]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=478}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=2108}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915]
+
{{#set: centisome position=7.531117   }}
* BIGG : udpgalfur
+
{{#set: reaction associated=1.3.99.23-RXN|RXN-8042}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6475}}
** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733]
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
{{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}}
+
{{#set: common name=UDP-α-D-galactofuranose}}
+
{{#set: molecular weight=564.289   }}
+
{{#set: common name=UDP-Galf}}
+
{{#set: consumed or produced by=GALPMUT-RXN}}
+

Revision as of 01:07, 19 March 2018

Gene Tiso_gene_13367

  • left end position:
    • 478
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2108
  • centisome position:
    • 7.531117
  • Synonym(s):

Reactions associated

Pathways associated

External links