Difference between revisions of "RXN-15910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO-8P KDO-8P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)[CH]1(OC(O)(C([O-])=O)CC(C1O)O) * inchi k...")
(Created page with "Category:Gene == Gene Tiso_gene_17372 == * left end position: ** 2233 * transcription direction: ** POSITIVE * right end position: ** 3738 * centisome position: ** 59.6261...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO-8P KDO-8P] ==
+
== Gene Tiso_gene_17372 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])(=O)[O-])C(O)[CH]1(OC(O)(C([O-])=O)CC(C1O)O)
+
** 2233
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IZZNRKJLBIYBJN-HXUQBWEZSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-deoxy-D-manno-octulosonate 8-phosphate
+
** 3738
−
* molecular weight:
+
* centisome position:
−
** 315.15    
+
** 59.626167    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-deoxy-D-manno-octulosonate 8-P
 
−
** 2-dehydro-3-deoxy-D-octonate 8-P
 
−
** 2-dehydro-3-deoxy-D-octonate 8-phosphate
 
−
** Kdo-8P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.1.160-RXN]]
−
* [[KDO-8PSYNTH-RXN]]
+
** experimental_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6689]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2233}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91825728 91825728]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3738}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85985 85985]
+
{{#set: centisome position=59.626167   }}
−
* BIGG : kdo8p
+
{{#set: reaction associated=2.7.1.160-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6689}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04478 C04478]
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C(O)[CH]1(OC(O)(C([O-])=O)CC(C1O)O)}}
+
−
{{#set: inchi key=InChIKey=IZZNRKJLBIYBJN-HXUQBWEZSA-K}}
+
−
{{#set: common name=3-deoxy-D-manno-octulosonate 8-phosphate}}
+
−
{{#set: molecular weight=315.15   }}
+
−
{{#set: common name=3-deoxy-D-manno-octulosonate 8-P|2-dehydro-3-deoxy-D-octonate 8-P|2-dehydro-3-deoxy-D-octonate 8-phosphate|Kdo-8P}}
+
−
{{#set: produced by=KDO-8PSYNTH-RXN}}
+

Revision as of 00:08, 19 March 2018

Gene Tiso_gene_17372

  • left end position:
    • 2233
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3738
  • centisome position:
    • 59.626167
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-15910&oldid=28882"