Difference between revisions of "ACOA160or"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5180 RXN0-5180] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1 EC-2.5.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[FARNESYL-PP]][c] '''<=>''' 1 [[CPD0-1028]][c] '''+''' 1 [[PPI]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 isopentenyl diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] '''<=>''' 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] '''+''' 1 diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_11582]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | * [[Tiso_gene_2848]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_8531]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_18201]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | * [[Tiso_gene_10317]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31282 31282] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05555 R05555] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | * LIGAND- | + | {{#set: ec number=EC-2.5.1}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_11582|Tiso_gene_2848|Tiso_gene_8531|Tiso_gene_18201|Tiso_gene_10317}} |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:08, 19 March 2018
Contents
Reaction RXN0-5180
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DELTA3-ISOPENTENYL-PP[c] + 1 FARNESYL-PP[c] <=> 1 CPD0-1028[c] + 1 PPI[c]
- With common name(s):
- 1 isopentenyl diphosphate[c] + 1 (2E,6E)-farnesyl diphosphate[c] <=> 1 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
External links