Difference between revisions of "RXN-9660"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R468-RXN R468-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** cyanuric_acid_amidohydrolase...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R468-RXN R468-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** cyanuric_acid_amidohydrolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.2.15 EC-3.5.2.15] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[CYANURIC-ACID]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-809]][c] |
− | == | + | * With common name(s): |
+ | ** 1 cyanurate[c] '''+''' 1 H2O[c] '''=>''' 1 CO2[c] '''+''' 1 biuret[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_9325]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5169]], cyanurate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5169 PWY-5169] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | * RHEA: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14641 14641] |
− | {{#set: common name= | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07305 R07305] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=cyanuric_acid_amidohydrolase}} |
+ | {{#set: ec number=EC-3.5.2.15}} | ||
+ | {{#set: gene associated=Tiso_gene_9325}} | ||
+ | {{#set: in pathway=PWY-5169}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 00:08, 19 March 2018
Contents
Reaction R468-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- cyanuric_acid_amidohydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CYANURIC-ACID[c] + 1 WATER[c] => 1 CARBON-DIOXIDE[c] + 1 CPD-809[c]
- With common name(s):
- 1 cyanurate[c] + 1 H2O[c] => 1 CO2[c] + 1 biuret[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_9325
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links