Difference between revisions of "Tiso gene 7305"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Tiso_gene_5047 == * left end position: ** 11687 * transcription direction: ** POSITIVE * right end position: ** 13971 * centisome position: ** 83.639...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5047 == |
− | * | + | * left end position: |
− | ** | + | ** 11687 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 13971 |
− | * | + | * centisome position: |
− | ** | + | ** 83.63988 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[HISTCYCLOHYD-RXN]] |
− | + | ** in-silico_annotation | |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[HISTSYN-PWY]] |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=11687}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=13971}} | |
− | + | {{#set: centisome position=83.63988 }} | |
− | + | {{#set: reaction associated=HISTCYCLOHYD-RXN}} | |
− | + | {{#set: pathway associated=HISTSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 01:12, 19 March 2018
Gene Tiso_gene_5047
- left end position:
- 11687
- transcription direction:
- POSITIVE
- right end position:
- 13971
- centisome position:
- 83.63988
- Synonym(s):
Reactions associated
- HISTCYCLOHYD-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation