Difference between revisions of "Tiso gene 3974"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.89-RXN 3.4.21.89-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.89-RXN 3.4.21.89-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.4.21.89 EC-3.4.21.89] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[Peptides-with-Leader-Sequence]][c] '''=>''' 1 [[Leader-Sequences]][c] '''+''' 1 [[Peptides-holder]][c] | |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 a peptide with a leader sequence[c] '''=>''' 1 a leader sequence[c] '''+''' 1 a peptide[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_14208]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9RUF9 Q9RUF9] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9ZE32 Q9ZE32] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CDG2 Q9CDG2] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9KPB1 Q9KPB1] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9PBA0 Q9PBA0] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q57708 Q57708] |
− | * | + | ** [http://www.uniprot.org/uniprot/O67088 O67088] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JV66 Q9JV66] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PP67 Q9PP67] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9I5G7 Q9I5G7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q8FF16 Q8FF16] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q8XA33 Q8XA33] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P41026 P41026] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P41027 P41027] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P37943 P37943] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q57350 Q57350] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M0V9 Q7M0V9] |
+ | ** [http://www.uniprot.org/uniprot/P0A1W2 P0A1W2] | ||
+ | ** [http://www.uniprot.org/uniprot/P26844 P26844] | ||
+ | ** [http://www.uniprot.org/uniprot/P28628 P28628] | ||
+ | ** [http://www.uniprot.org/uniprot/P41025 P41025] | ||
+ | ** [http://www.uniprot.org/uniprot/Q51876 Q51876] | ||
+ | ** [http://www.uniprot.org/uniprot/Q52697 Q52697] | ||
+ | ** [http://www.uniprot.org/uniprot/Q45225 Q45225] | ||
+ | ** [http://www.uniprot.org/uniprot/P72660 P72660] | ||
+ | ** [http://www.uniprot.org/uniprot/P73157 P73157] | ||
+ | ** [http://www.uniprot.org/uniprot/O69884 O69884] | ||
+ | ** [http://www.uniprot.org/uniprot/P00803 P00803] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-3.4.21.89}} | ||
+ | {{#set: gene associated=Tiso_gene_14208}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Revision as of 00:12, 19 March 2018
Contents
Reaction 3.4.21.89-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Peptides-with-Leader-Sequence[c] => 1 Leader-Sequences[c] + 1 Peptides-holder[c]
- With common name(s):
- 1 H2O[c] + 1 a peptide with a leader sequence[c] => 1 a leader sequence[c] + 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- UNIPROT: