Difference between revisions of "CPD-13014"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NEUROSPORENE NEUROSPORENE] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOx NODOx] == * direction: ** LEFT-TO-RIGHT * common name: ** nitric oxide, NADH2:oxygen oxidored...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NEUROSPORENE NEUROSPORENE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NODOx NODOx] ==
* smiles:
+
* direction:
** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ATCICVFRSJQYDV-XILUKMICSA-N
+
 
* common name:
 
* common name:
** all-trans neurosporene
+
** nitric oxide, NADH2:oxygen oxidoreductase
* molecular weight:
+
** 538.898   
+
 
* Synonym(s):
 
* Synonym(s):
** 7,8-dihydro-ψ,ψ-carotene
 
** neurosporene
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R96]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 2.0 [[OXYGEN-MOLECULE]][c] '''+''' 2.0 [[NITRIC-OXIDE]][c] '''+''' 1.0 [[NADH]][c] '''=>''' 2.0 [[NITRATE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NAD]][c]
* [[RXN-8022]]
+
* With common name(s):
* [[R95]]
+
** 2.0 oxygen[c] '''+''' 2.0 nitric oxide[c] '''+''' 1.0 NADH[c] '''=>''' 2.0 nitrate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NAD+[c]
== Reaction(s) of unknown directionality ==
+
 
* [[RXN-8038]]
+
== Genes associated with this reaction  ==
* [[RXN-8040]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_4015]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070086
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=nitric oxide, NADH2:oxygen oxidoreductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280789 5280789]
+
{{#set: gene associated=Tiso_gene_4015}}
* HMDB : HMDB03114
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C05431 C05431]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.4444347.html 4444347]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16833 16833]
+
{{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=ATCICVFRSJQYDV-XILUKMICSA-N}}
+
{{#set: common name=all-trans neurosporene}}
+
{{#set: molecular weight=538.898    }}
+
{{#set: common name=7,8-dihydro-ψ,ψ-carotene|neurosporene}}
+
{{#set: consumed by=R96}}
+
{{#set: produced by=RXN-8022|R95}}
+
{{#set: consumed or produced by=RXN-8038|RXN-8040}}
+

Revision as of 00:13, 19 March 2018

Reaction NODOx

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nitric oxide, NADH2:oxygen oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 2.0 oxygen[c] + 2.0 nitric oxide[c] + 1.0 NADH[c] => 2.0 nitrate[c] + 1.0 H+[c] + 1.0 NAD+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links